BIOPEP-UWM: Report
| ID | 8687 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 291.3018 | Monoisotopic mass | 291.1215 | |
| IC50 : | 643.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derivedpeptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C14H17N3O4/c15-10(13(19)17-12(7-18)14(20)21)5-8-6-16-11-4-2-1-3-9(8)11/h1-4,6,10,12,16,18H,5,7,15H2,(H,17,19)(H,20,21)/t10-,12-/m0/s1 InChIKey= MYVYPSWUSKCCHG-JQWIXIFHSA-N |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 241 |