BIOPEP-UWM: Report
| ID | 8692 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 351.3982 | Monoisotopic mass | 351.1578 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derivedpeptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)Cc1c[nH]c2c1cccc2 InChI=1S/C20H21N3O3/c21-16(11-14-12-22-17-9-5-4-8-15(14)17)19(24)23-18(20(25)26)10-13-6-2-1-3-7-13/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1 InChIKey: IMMPMHKLUUZKAZ-WMZOPIPTSA-N Bitter peptide according to BIOPEP database of sensory peptides and amino acids |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 340 BRENDA: Ligand Trp-Phe ChEBI: ID 74874 ChEMBL: ID CHEMBL288827 ChemSpider: ID 4932360 PubChem: ID 6426942 ZINC: ID ZINC02033819 |