BIOPEP-UWM: Report
| ID | 8697 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 261.2759 | Monoisotopic mass | 261.1110 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derived peptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)NCC(=O)O InChI=1S/C13H15N3O3/c14-10(13(19)16-7-12(17)18)5-8-6-15-11-4-2-1-3-9(8)11/h1-4,6,10,15H,5,7,14H2,(H,16,19)(H,17,18)/t10-/m0/s1 InChIKey: UYKREHOKELZSPB-JTQLQIEISA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 7613); the EROP-Moscow database Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9082) |
| Database reference: |
| AHTPDB: ID 1485, 3091, 3816, 4051, 4407, 4522, 4695, 6599 BindingDB: ID 50188498 BioPepDB: ID biopep01517 BIOPEP-UWM database of bioactive peptides: ID 7613; 9082 BRENDA: Ligand Trp-Gly ChEBI: ID 74870 ChEMBL: ID CHEMBL327588 ChemSpider: ID 87619 EROP-Moscow: ID E10396 FDA SRS: ID GLE75A3004 J-GLOBAL: ID 200907023317662394 Metabolights: ID MTBLC74870 Nikkaji: ID J149.653K PubChem: CID 97054 SATPdb: ID satpdb11095 SureChEMBL: ID SCHEMBL8699875 ZINC: ID ZINC000002384992 |