BIOPEP-UWM: Report
| ID | 8737 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 630.6893 | Monoisotopic mass | 630.2793 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu J., Jin Y., Lin S., Jones G.S., Chen F. | |
| Title | |
| Purification and identification of novel antioxidant peptides from egg white protein and their antioxidant activities. Food Chemistry 175, 258–266, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(N)=O)C(O)=O InChI=1S/C33H38N6O7/c34-24(16-21-10-4-1-5-11-21)30(42)38-25(17-22-12-6-2-7-13-22)31(43)36-20-29(41)37-26(18-23-14-8-3-9-15-23)32(44)39-27(33(45)46)19-28(35)40/h1-15,24-27H,16-20,34H2,(H2,35,40)(H,36,43)(H,37,41)(H,38,42)(H,39,44)(H,45,46)/t24-,25-,26-,27-/m0/s1 InChIKey: OLHLJVOFWOVHCZ-FWEHEUNISA-N |
| Database reference: |
| EROP-Moscow: ID E23621 FeptideDB: ID 8737 |