BIOPEP-UWM: Report
| ID | 8738 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 682.7880 | Monoisotopic mass | 682.3098 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu J., Jin Y., Lin S., Jones G.S., Chen F. | |
| Title | |
| Purification and identification of novel antioxidant peptides from egg white protein and their antioxidant activities. Food Chemistry 175, 258–266, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCSC)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C29H46N8O9S/c1-15(2)10-21(29(45)46)36-26(42)19(11-17-13-31-14-32-17)34-24(40)16(3)33-25(41)20(12-23(38)39)35-27(43)22-6-5-8-37(22)28(44)18(30)7-9-47-4/h13-16,18-22H,5-12,30H2,1-4H3,(H,31,32)(H,33,41)(H,34,40)(H,35,43)(H,36,42)(H,38,39)(H,45,46)/t16-,18-,19-,20-,21-,22-/m0/s1 InChIKey: GERYRFQHPGVNET-PLOPKLDOSA-N |
| Database reference: |
| J-GLOBAL: ID 201507040497844109 Nikkaji: ID J3.367.829K PubChem: CID 101893750 |