BIOPEP-UWM: Report
| ID | 8743 |
| Name | Antioxidant peptide from chickpea |
| sequence |
| Function: | |||
| Antioxidant | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 836.8901 | Monoisotopic mass | 836.4128 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Torres-Fuentes C., Contreras M.D.M., Recio I., Alaiz M., Vioque J. | |
| Title | |
| Identification and characterization of antioxidant peptides from chickpea protein hydrolysates. Food Chemistry, 80, 194-202, doi:10.1016/j.foodchem.2015.02.046. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C35H56N12O12/c1-17(2)12-22(44-28(52)18(3)36)29(53)42-20(8-9-26(48)49)33(57)47-11-5-7-25(47)32(56)46-24(14-27(50)51)31(55)45-23(13-19-15-39-16-41-19)30(54)43-21(34(58)59)6-4-10-40-35(37)38/h15-18,20-25H,4-14,36H2,1-3H3,(H,39,41)(H,42,53)(H,43,54)(H,44,52)(H,45,55)(H,46,56)(H,48,49)(H,50,51)(H,58,59)(H4,37,38,40)/t18-,20-,21-,22-,23-,24-,25+/m0/s1 InChIKey: QHDVJHQGWCJCGX-JDKXXNDASA-N Bitter peptide according to the BIOPEP database of sensory peptides and amino acids |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 396 |