BIOPEP-UWM: Report
| ID | 8753 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 835.8591 | Monoisotopic mass | 835.3812 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yan Q.-J., Huang L.-H., Sun Q., Jiang Z.-Q., Wu X. | |
| Title | |
| Isolation, identification and synthesis of four novel antioxidant peptides from rice residue protein hydrolyzed by multiple proteases. Food Chemistry 179, 290-295, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@]([H])(CC(N)=O)NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(N)CCCNC(N)=N)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C35H53N11O13/c1-16(34(58)59)41-28(52)23(15-26(50)51)44-32(56)27(17(2)47)45-30(54)21(13-18-7-9-19(48)10-8-18)42-29(53)22(14-25(37)49)43-31(55)24-6-4-12-46(24)33(57)20(36)5-3-11-40-35(38)39/h7-10,16-17,20-24,27,47-48H,3-6,11-15,36H2,1-2H3,(H2,37,49)(H,41,52)(H,42,53)(H,43,55)(H,44,56)(H,45,54)(H,50,51)(H,58,59)(H4,38,39,40)/t16-,17+,20-,21-,22-,23-,24-,27-/m0/s1 InChIKey: APHPNEZBEYCUPL-RRMUNLETSA-N |
| Database reference: |
| J-GLOBAL: ID 201507079873725772 Nikkaji: ID J3.384.012H PubChem: CID 101907004 |