BIOPEP-UWM: Report
| ID | 8756 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 641.6739 | Monoisotopic mass | 641.2913 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yan Q.-J., Huang L.-H., Sun Q., Jiang Z.-Q., Wu X. | |
| Title | |
| Isolation, identification and synthesis of four novel antioxidant peptides from rice residue protein hydrolyzed by multiple proteases. Food Chemistry 179, 290-295 (2015) | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C29H39N9O8/c30-18(13-24(32)40)25(41)36-20(11-16-5-2-1-3-6-16)26(42)37-21(12-17-14-33-15-34-17)28(44)38-10-4-7-22(38)27(43)35-19(29(45)46)8-9-23(31)39/h1-3,5-6,14-15,18-22H,4,7-13,30H2,(H2,31,39)(H2,32,40)(H,33,34)(H,35,43)(H,36,41)(H,37,42)(H,45,46)/t18-,19-,20-,21-,22-/m0/s1 InChIKey: NBVRTXMOALFHTA-YFNVTMOMSA-N |
| Database reference: |
| FeptideDB: ID 8756 J-GLOBAL: ID 201507026381422530 Nikkaji: ID J3.384.014D PubChem: CID 101907006 |