BIOPEP-UWM: Report
| ID | 8759 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 236.2664 | Monoisotopic mass | 236.1157 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C12H16N2O3/c1-8(13)11(15)14-10(12(16)17)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 InChIKey=OMNVYXHOSHNURL-WPRPVWTQSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 7583) Inhibitor of Tripeptidyl peptidase 2 (EC 3.4.14.10) (MEROPS ID: S08.090 ) according to the BIOPEP-UWM database of bioactive peptides; the BRENDA database; the ChEMBL database |
| Database reference: |
| AHTPDB: ID 1271; 1363; 1410; 1503; 1678; 1892; 1896; 2591; 2747; 3031; 3222; 3344; 3419; 3465; 3790; 3846; 3886; 4441; 4496; 4679; 5429; 5787; 6211; 6569 BindingDB: ID 50188503 BIOPEP-UWM database of bioactive peptides: ID 7583 BIOPEP-UWM database of sensory peptides and amino acids: ID 50 BRENDA: Ligand Ala-Phe CAS: Registry No 3061-90-3 ChEBI: ID 73807 ChEMBL: ID CHEMBL57338 ChemIDPlus: ID 3061-90-3 ChemSpider ID: 87414 DFBP: ID DFBPACEI0116; EPA CompTox: ID DTXSID801312981 EROP-Moscow: ID E04069; E03700 FooDB: ID FDB111753 HMDB: ID HMDB0028694 J-GLOBAL: ID 200907056679638527 MeSH: Terms Ala-Phe; alanylphenylalanine; L-alanyl-L-phenylalanine Metabolights: ID MTBLC73807 Metabolomics Workbench: ID 78669 Nikkaji: ID J80.627G NMRShiftDB: ID 60022205 PlantPepDB: ID PPepDB_241 ProbesDrugs: ID PD165131 PubChem: ID 6992394 ZINC: ID ZINC01575524 |