BIOPEP-UWM: Report
| ID | 8760 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 146.1441 | Monoisotopic mass | 146.0689 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)NCC(=O)O InChI=1S/C5H10N2O3/c1-3(6)5(10)7-2-4(8)9/h3H,2,6H2,1H3,(H,7,10)(H,8,9)/t3-/m0/s1 InChIKey=CXISPYVYMQWFLE-VKHMYHEASA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 7600), the ChEMBL database; the DFBP database, the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1481, 1687, 2983, 3049, 3089, 3094, 3234, 3360, 3466, 3553, 3805, 3887, 4420, 4511, 4662, 6586 BindingDB: ID 50169210 BioCyc: Compound ALA-GLY BioPepDB: ID 7600; 8760 BIOPEP-UWM database of bioactive peptides: ID 7600 CAS: Registry No 687-69-4 ChEBI: ID 73757 ChEMBL: ID CHEMBL94250 ChemSpider: ID 5365657 DFBP: ID DFBPACEI1557 ECHA: ID 211-699-9 EcoCyc: Compound ALA-GLY EPA CompTox: ID DTXSID101316944 EROP-Moscow: ID E10393 HMDB: ID HMDB0006899 J-GLOBAL: ID 200907098546421244 MetaboLights: ID MTBLC73786 Metabolomics Workbench: ID 78663 MetaNetX: ID MNXM15783 Nikkaji: ID J79.786C PubChem: CID 6998029 Sabio-RK: ID 28253 SATPdb: ID satpdb22449 Seed: ID cpd11585 UniChem: ID 38896 UNII: ID QXQ6Y9X6ZS Wikidata: ID Q27144089 ZINC: ID ZINC000001888744 |