BIOPEP-UWM: Report
| ID | 8770 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 204.1801 | Monoisotopic mass | 204.0743 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@H](C(=O)NCC(=O)O)CCC(=O)O InChI=1S/C7H12N2O5/c8-4(1-2-5(10)11)7(14)9-3-6(12)13/h4H,1-3,8H2,(H,9,14)(H,10,11)(H,12,13)/t4-/m0/s1 InChIKey: LSPKYLAFTPBWIL-BYPYZUCNSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to the AHTPDB database; the BindingDB; the BIOPEP database of bioactive peptides; the ChEMBL database; the PubChem database Antagonist of neuroexcitatory amino acids according to ChEMBL database; PubChem database Bitter peptide according to BIOPEP database of sensory peptides and amino acids (ID 232) Umami peptide according to BIOPEP database of sensory peptides and amino acids (ID 358) |
| Database reference: |
| AHTPDB: ID 1487; 3142; 3254; 3335; 3825; 3898; 4398; 4531; 4663; 6609 BindingDB: ID 50188507 BIOPEP database of bioactive peptides: ID 7622 BIOPEP database of sensory peptides and amino acids: ID 232; 358 ChEBI: ID 73505 ChEMBL: ID CHEMBL421361 ChemSpider: ID 4932470 EROP-Moscow: ID E01847 PubChem: ID 6427052 SATpdb: ID satpdb21475 ZINC: ID ZINC01731776 |