BIOPEP-UWM: Report
| ID | 8774 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 248.2325 | Monoisotopic mass | 248.1004 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)O)[C@H](O)C)CCC(=O)O InChI=1S/C9H16N2O6/c1-4(12)7(9(16)17)11-8(15)5(10)2-3-6(13)14/h4-5,7,12H,2-3,10H2,1H3,(H,11,15)(H,13,14)(H,16,17)/t4-,5+,7+/m1/s1 InChIKey: JSIQVRIXMINMTA-ZDLURKLDSA-N Umami peptide according to the BIOPEP database of sensory peptides and amino acids (ID 406) |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 406 ChEBI: ID 73510 PubChem: ID 6998031 ZINC: ID ZINC01888747 |