BIOPEP-UWM: Report
| ID | 8780 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 321.3739 | Monoisotopic mass | 321.1796 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C15H23N5O3/c16-11(9-10-5-2-1-3-6-10)13(21)20-12(14(22)23)7-4-8-19-15(17)18/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/t11-,12-/m0/s1 InChIKey=OZILORBBPKKGRI-RYUDHWBXSA-N Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM database of bioactive peptides (ID 9501); the BRENDA database Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 7592); the BRENDA database; the ChEMBL database |
| Database reference: |
| ACToR: ID 1238-09-1 AHTPDB: ID 3363; 3481; 3833; 3911; 4429; 4539; 4687; 6578 BindingDB: ID 50407458 BioPepDB: ID biopep00280 BIOPEP-UWM database of bioactive peptides: ID 7592; 9501 BRENDA: Ligand Phe-Arg ChEBI: ID 73632 ChEMBL: ID CHEMBL291636 ChemSpider: ID 133005 EROP-Moscow: ID E01801 HMDB: ID HMDB0028989 J-GLOBAL: ID 200907017930259977 Metabolights: ID MTBLC73632 Nikkaji: ID J80.106 ParaPep: ID 1268, 1708 PubChem: CID 150903 SATPdb: ID satpdb10396 SureChEMBL: ID SCHEMBL1711701 ZINC: ID ZINC000002384770 |