BIOPEP-UWM: Report
| ID | 8786 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 174.1971 | Monoisotopic mass | 174.1001 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: NCC(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C7H14N2O3/c1-4(2)6(7(11)12)9-5(10)3-8/h4,6H,3,8H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1 InChIKey: STKYPAFSDFAEPH-LURJTMIESA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database; BindingDB; BIOPEP database of bioactive peptides (ID 7608); ChEMBL database; EROP-Moscow database; PubChem database Inhibitor of citrulline uptake in yeasts according to ChEMBL database; PubChem database Bitter peptide according to BIOPEP database of sensory peptides and amino acids (ID 106); ChEMBL database; PubChem database |
| Database reference: |
| AHTPDB: ID 1429; 1689; 3021; 3026; 3098; 3119; 3140; 3160; 3241; 3333; 3423; 3811; 3837; 3936; 4412; 4517; 4680; 5435; 6170; 6594 BindingDB: ID 50407462 BIOPEP database of bioactive peptides: ID 7608 BIOPEP database of sensory peptides and amino acids: ID 8786 BRENDA: Ligand Gly-Val ChEBI: ID 73922 ChEMBL: ID CHEMBL56035 ChemSpider: ID 2006926 Crystallography Open Database (COD): ID 2015750 EROP-Moscow: ID E10385 PubChem: ID 2724807 ZINC: ID ZINC01730674 |