BIOPEP-UWM: Report
| ID | 8800 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 268.3114 | Monoisotopic mass | 268.1531 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC[C@H](C)[C@@H](C(=O)N[C@@H](CC1=CN=CN1)C(=O)O)N InChI=1S/C12H20N4O3/c1-3-7(2)10(13)11(17)16-9(12(18)19)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t7-,9-,10-/m0/s1 InChIKey=QNBYCZTZNOVDMI-HGNGGELXSA-N Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM database of bioactive peptides (ID 9497) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9497 ChEBI: ID 73520 ChemSpider: ID 5382048 J-GLOBAL: ID 200907081050919080 Nikkaji: ID J1.064.342B PubChem: CID 7019081 ZINC: ID ZINC2556612 |