BIOPEP-UWM: Report
| ID | 8813 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 274.3588 | Monoisotopic mass | 274.1999 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C12H26N4O3/c13-7-3-1-5-9(15)11(17)16-10(12(18)19)6-2-4-8-14/h9-10H,1-8,13-15H2,(H,16,17)(H,18,19)/t9-,10-/m0/s1 InChIKey=NVGBPTNZLWRQSY-UWVGGRQHSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides Bacterial permease ligand according to the BIOPEP-UWM database (ID 3751) Inhibitor of Neprilysin (EC 3.4.24.11) (MEROPS ID: M13.001) according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| ACToR: ID 13184-13-9 BindingDB: ID 50188512 BIOPEP-UWM database of bioactive peptides: ID 3751 BRENDA: Ligand L-Lys-L-Lys CAS: Registry No 13184-13-9 ChEBI: ID 74564 ChEMBL: ID CHEMBL379332 ChemSpider: ID 114170 EPA CompTox: ID DTXSID00927364 EROP-Moscow: ID E09291 FooDB: ID FDB111979 HMDB: ID HMDB0028956 J-GLOBAL: ID 200907051674543321 Metabolights: ID MTBLC74564 Metabolomics Workbench: ID 78887 MMDB: ID 6217.2 Nikkaji: ID J81.564K PlantPepDB: ID PPepDB_2579 PubChem: CID 128837 SureChEMBL: ID SCHEMBL1070057 UniChem: ID 378249 UNII: ID 96TER1JROC Wikidata: ID Q27144740 ZINC: ID ZINC000002043137 |