BIOPEP-UWM: Report
| ID | 8829 | 
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) – Wheylin-1 | 
| sequence | 
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2   | 
    Activity code | dpp   | 
  
| Activity : | dipeptidyl peptidase IV inhibitor   | 
  |||
| Chemical mass | 286.3510 | Monoisotopic mass | 286.1096 | |
| EC50 : | 0.00  µM   | 
  |||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source | 
| 2015 | Journal | 
| Additional information: | 
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCSC)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)O InChI=1S/C11H18N4O3S/c1-19-3-2-8(12)10(16)15-9(11(17)18)4-7-5-13-6-14-7/h5-6,8-9H,2-4,12H2,1H3,(H,13,14)(H,15,16)(H,17,18)/t8-,9-/m0/s1 InChIKey=MWAYJIAKVUBKKP-IUCAKERBSA-N Anxiolytic-like peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10111)  | 
  
| Database reference: | 
| BIOPEP-UWM database of bioactive peptides: ID 10111 BRENDA: Ligand Met-His ChEBI: ID 74703 ChEMBL: ID CHEMBL1222264 ChemSpider: ID 5731049 FeptideDB: ID 8829 J-GLOBAL: ID 200907076057609261 MeSH: term wheylin-1 Metabolights: ID MTBLC74703 Nikkaji: ID J562.409F PubChem: CID 7408323 SureChEMBL: ID SCHEMBL7047388 ZINC: ID ZINC000004899611  |