BIOPEP-UWM: Report
| ID | 8831 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 277.3838 | Monoisotopic mass | 277.1455 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C11H23N3O3S/c1-18-7-5-8(13)10(15)14-9(11(16)17)4-2-3-6-12/h8-9H,2-7,12-13H2,1H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1 InChIKey=IMTUWVJPCQPJEE-IUCAKERBSA-N Inhibitor of ABC-type dipeptide transporter (EC 7.4.2.9) according to the BRENDA database Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM Virtual database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8831 BRENDA: Ligand L-Met-L-Lys CAS: Registry No 45214-88-8 ChEBI: ID 74706 ChemSpider: ID 5379134 EPA DSSTox: ID DTXSID40426801 HMDB: ID HMDB28978 J-GLOBAL: ID 200907075473717832 Metabolights: ID MTBLC74706 Metabolomics Workbench: ID 78907 Nikkaji: ID J151.287K PubChem: CID 7016112 SureChEMBL: ID 29376623 UniChem: ID 25665864 Wikidata: ID Q27144844 ZINC: ID ZINC000002522671 |