BIOPEP-UWM: Report
| ID | 8833 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 280.4088 | Monoisotopic mass | 280.0911 | |
| EC50 : | 93.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C10H20N2O3S2/c1-16-5-3-7(11)9(13)12-8(10(14)15)4-6-17-2/h7-8H,3-6,11H2,1-2H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1 InChIKey: ZYTPOUNUXRBYGW-YUMQZZPRSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9085) Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9086) |
| Database reference: |
| BindingDB: ID 50350482 BIOPEP-UWM database of bioactive peptides: ID 9085; 9086 BRENDA: Ligand Met-Met ChEBI: ID 74707 ChEMBL: ID CHEMBL1222165 ChemSpider: ID 5361185 J-GLOBAL: ID 200907019952150718 Metabolights: ID MTBLC74707 Nikkaji: ID J81.378H PubChem: CID 6993082 SureChEMBL: ID SCHEMBL1157691 ZINC: ID ZINC01605257 |