BIOPEP-UWM: Report
| ID | 8858 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 243.3019 | Monoisotopic mass | 243.1578 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: C1C[C@H](NC1)C(=O)N[C@@H](CCCCN)C(=O)O InChI=1S/C11H21N3O3/c12-6-2-1-4-9(11(16)17)14-10(15)8-5-3-7-13-8/h8-9,13H,1-7,12H2,(H,14,15)(H,16,17)/t8-,9-/m0/s1 InChIKey: RVQDZELMXZRSSI-IUCAKERBSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids |
| Database reference: |
| AHTPDB: ID 5443 BindingDB: ID 50188505 BioPepDB: ID biopep01057 BIOPEP-UWM database of sensory peptides and amino acids: ID 15 BRENDA: Ligand Pro-Lys ChEBI: ID 74792 ChEMBL: ID CHEMBL377325 ChemSpider: ID 7498109 FeptideDB: ID 8858 J-GLOBAL: ID 201207037096316360 Metabolights: ID MTBLC74792 Nikkaji: ID J3.017.783E PubChem: CID 9209431 SATPdb: ID satpdb17074 SureChEMBL: ID SCHEMBL18075734 ZINC: ID ZINC000008076544 |