BIOPEP-UWM: Report
| ID | 8859 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 246.3269 | Monoisotopic mass | 246.1034 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C10H18N2O3S/c1-16-6-4-8(10(14)15)12-9(13)7-3-2-5-11-7/h7-8,11H,2-6H2,1H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1 InChIKey=MTWJTFBVRDGROD-YUMQZZPRSA-N Inhibitor of Angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID M02-001) according to the BRENDA database; the EROP-Moscow database |
| Database reference: |
| BRENDA: Ligand Pro-Met ChEBI: ID 141444 ChemSpider: ID 5730923 EPA DSSTox: ID DTXCID10379416 EROP-Moscow: ID E21316 FeptideDB: ID 8859 J-GLOBAL: ID 200907007947788668 Nikkaji: ID J151.042H PubChem: CID 7408172 |