BIOPEP-UWM: Report
| ID | 8869 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 275.2578 | Monoisotopic mass | 275.1113 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C10H17N3O6/c11-5(1-3-7(12)14)9(17)13-6(10(18)19)2-4-8(15)16/h5-6H,1-4,11H2,(H2,12,14)(H,13,17)(H,15,16)(H,18,19)/t5-,6-/m0/s1 InChIKey=OWOFCNWTMWOOJJ-WDSKDSINSA-N |
| Database reference: |
| BindingDB: ID 50188514 BRENDA: Ligand Gln-Glu CAS: Registry No 88830-90-4 ChEBI: ID 73847 ChEMBL: ID CHEMBL210850 ChemSpider: ID 5382986 EPA CompTox: ID DTXSID501309175 HMDB: ID HMDB0028796 Metabolights: ID MTBLC73847 Metabolomics Workbench: ID 78762 PubChem: CID 7020029 SureChEMBL: ID SCHEMBL435320 UniChem: ID 179877 UNII: ID EK6VPV7VWH Wikidata: ID Q27144170 ZINC: ID ZINC000002560992 |