BIOPEP-UWM: Report
| ID | 8892 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 242.2313 | Monoisotopic mass | 242.1012 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CO)C(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)O InChI=1S/C9H14N4O4/c10-6(3-14)8(15)13-7(9(16)17)1-5-2-11-4-12-5/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)/t6-,7-/m0/s1 InChIKey=YZMPDHTZJJCGEI-BQBZGAKWSA-N |
| Database reference: |
| BRENDA: Ligand Ser-His ChEBI: ID 73651 ChEMBL: ID CHEMBL123541 EPA DSSTox: ID DTXSID10426797 FeptideDB:ID 8892 HMDB: ID HMDB0029041 J-GLOBAL: ID 200907009366007943 Metabolights: ID MTBLC73651 Nikkaji: ID J2.008.872I PubChem: CID 7016094 SureChEMBL: ID SCHEMBL2132240 ZINC: ID ZINC000002522642 |