BIOPEP-UWM: Report
| ID | 8894 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 233.2641 | Monoisotopic mass | 233.1371 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C9H19N3O4/c10-4-2-1-3-7(9(15)16)12-8(14)6(11)5-13/h6-7,13H,1-5,10-11H2,(H,12,14)(H,15,16)/t6-,7-/m0/s1 InChIKey=SBMNPABNWKXNBJ-BQBZGAKWSA-N |
| Database reference: |
| BRENDA: Ligand Ser-Lys ChEBI: ID 144702 ChemSpider: ID 17279435 EPA CompTox: ID DTXSID10583091 EPA DSSTox: ID DTXCID30533856 FeptideDB: ID 8894 FooDB: ID FDB112052 HMDB: ID HMDB0029044 J-GLOBAL: ID 200907089802354623 MetaboLights: ID MTBLS1115 Nikkaji: ID J1.784.013D PubChem: CID 16122513 SureChEMBL: ID SCHEMBL18806290 |