BIOPEP-UWM: Report
| ID | 8915 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 232.2331 | Monoisotopic mass | 232.1055 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C9H16N2O5/c1-4(2)7(10)8(14)11-5(9(15)16)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t5-,7-/m0/s1 InChIKey=OBTCMSPFOITUIJ-FSPLSTOPSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 493); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 3063, 3100, 3105, 3282, 3323, 3439, 4036, 5438, 6732 BioPepDB: ID biopep01342 BIOPEP-UWM database of sensory peptides and amino acids: ID 493 ChEBI: ID 75009 ChemSpider: ID 5373188 EROP-Moscow: ID E01853 FeptideDB: ID 8915 FooDB: ID FDB112125 HMDB: ID HMDB0029123 J-GLOBAL: ID 200907001001733687 Nikkaji: ID J150.481I PlantPepDB: ID PPepDB_199 PubChem: CID 7009608 SATPdb: ID satpdb23662 SDBS: ID 9387 |