BIOPEP-UWM: Report
| ID | 8921 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 245.3177 | Monoisotopic mass | 245.1734 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C11H23N3O3/c1-7(2)9(13)10(15)14-8(11(16)17)5-3-4-6-12/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17)/t8-,9-/m0/s1 InChIKey=JKHXYJKMNSSFFL-IUCAKERBSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 7558); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1412, 1676, 2684, 3077, 3159, 3217, 3331, 3416, 3543, 4040, 6544 BioPepDB: ID biopep01389 BIOPEP-UWM database of bioactive peptides: ID 7558 ChEBI: ID 75014 ChemIDplus: ID 22677-62-9 ChemSpider: ID 147014 EPA DSSTox: ID DTXSID80177209 EROP-Moscow: ID E04097 FeptideDB: ID 7558, 8921 HMDB: ID HMDB0029132 J-GLOBAL: ID 200907054600242574 Nikkaji number:J1.316.520C PlantPepDB: ID PPepDB_3850 PubChem: CID 168058 SATPdb: ID satpdb25656 |