BIOPEP-UWM: Report
| ID | 8923 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 248.3427 | Monoisotopic mass | 248.1190 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C10H20N2O3S/c1-6(2)8(11)9(13)12-7(10(14)15)4-5-16-3/h6-8H,4-5,11H2,1-3H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1 InChIKey=YSGSDAIMSCVPHG-YUMQZZPRSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9882); the EROP-Moscow database |
| Database reference: |
| BindingDB: ID 50085119 BIOPEP-UWM database of bioactive peptides: ID 9882 BRENDA: Ligand Val-Met-OH ChEBI: ID 75015 ChemSpider: ID 5361146 EROP-Moscow: ID E23995 FeptideDB: ID 7923 FooDB: ID FDB112135 HMDB: ID HMDB0029133 J-GLOBAL: ID 200907081349152886 Nikkaji: ID J150.500I PubChem: CID 6993039 SDBS: ID SDBS-9431 ZINC: ID ZINC1601795 |