BIOPEP-UWM: Report
| ID | 8926 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 204.2230 | Monoisotopic mass | 204.1106 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptide SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C8H16N2O4/c1-4(2)6(9)7(12)10-5(3-11)8(13)14/h4-6,11H,3,9H2,1-2H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1 InChIKey=STTYIMSDIYISRG-WDSKDSINSA-N |
| Database reference: |
| BRENDA: Ligand L-valinyl-L-serine ChEBI: ID 75021 ChEMBL: ID CHEMBL1221610 ChemSpider: ID 5360764 EROP-Moscow: ID E06687 FeptideDB: ID 8926 FooDB: ID FDB112137 HMDB: ID HMDB0029136 J-GLOBAL: ID 200907030741721488 Metabolights: ID MTBLC75021 Nikkaji: ID J150.524F PubChem: CID 6992640 ZINC: ID ZINC000001578621 |