BIOPEP-UWM: Report
| ID | 8937 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 318.3271 | Monoisotopic mass | 318.1324 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)O InChI=1S/C15H18N4O4/c16-12(5-9-1-3-11(20)4-2-9)14(21)19-13(15(22)23)6-10-7-17-8-18-10/h1-4,7-8,12-13,20H,5-6,16H2,(H,17,18)(H,19,21)(H,22,23)/t12-,13-/m0/s1 InChIKey: ZQOOYCZQENFIMC-STQMWFEESA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 9087) Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM database of bioactive peptides (ID 9481) |
| Database reference: |
| AHTPDB: ID 1453, 1815, 2771, 4256, 4730, 5183, 6266, 6872 BioPepDB: ID biopep01568 BIOPEP-UWM database of bioactive peptides: ID 9087; 9481 ChEBI: ID 73695 ChemSpider: ID 5383137 EPA DSSTox: ID DTXCID90378063 PubChem: CID 7020181 SATPdb: ID satpdb23731 ZINC: ID ZINC02561126 |