BIOPEP-UWM: Report
| ID | 8945 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 268.2652 | Monoisotopic mass | 268.1055 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lan V. T. T., Ito K., Ohno M., Motoyama T., Ito S., Kawarasaki Y. | |
| Title | |
| Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chemistry 175, 66-73, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C12H16N2O5/c13-9(5-7-1-3-8(16)4-2-7)11(17)14-10(6-15)12(18)19/h1-4,9-10,15-16H,5-6,13H2,(H,14,17)(H,18,19)/t9-,10-/m0/s1 InChIKey=ZSXJENBJGRHKIG-UWVGGRQHSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 6934 BRENDA: Ligand L-tyrosinyl-L-serine CAS: Registry No 13588-99-3 ChEBI: ID 141457 EPA CompTox: ID DTXSID90712241 EROP-MOscow: ID E10415 FooDB: ID FDB112117 HMDB: ID HMDB0029114 J-GLOBAL: ID 200907062957084317 Metabolomics Workbench: ID 79031 Nikkaji: ID J2.748.178G Plant Metabolite Hub: ID MS000243604 PubChem: CID 54564570 SATPdb: ID satpdb24541 SureChEMBL: ID SCHEMBL9852121 UniChem: ID 22887225 Wikidata: ID Q82648127 |