BIOPEP-UWM: Report
| ID | 8949 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 471.5067 | Monoisotopic mass | 471.2434 | |
| IC50 : | 530.21 µM |
|||
| Bibliographic data: | |
| Authors | |
| Salampessy J., Reddy N., Kailasapathy K., Phillips M. | |
| Title | |
| Functional and potential therapeutic ACE-inhibitory peptides derived from bromelain hydrolysis of trevally proteins. J. Funct. Foods 14, 716-725 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C19H33N7O7/c1-10(20)17(31)26-9-3-5-13(26)16(30)24-11(6-7-14(27)28)15(29)25-12(18(32)33)4-2-8-23-19(21)22/h10-13H,2-9,20H2,1H3,(H,24,30)(H,25,29)(H,27,28)(H,32,33)(H4,21,22,23)/t10-,11-,12-,13-/m0/s1 InChIKey=ATDYYCAPQPTXQJ-CYDGBPFRSA-N |
| Database reference: |
| EROP-Moscow: ID E16893 |