BIOPEP-UWM: Report
| ID | 8951 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 188.2236 | Monoisotopic mass | 188.1157 | |
| IC50 : | 956.28 µM |
|||
| Bibliographic data: | |
| Authors | |
| Salampessy J., Reddy N., Kailasapathy K., Phillips M. | |
| Title | |
| Functional and potential therapeutic ACE-inhibitory peptides derived from bromelain hydrolysis of trevally proteins. J. Funct. Foods 14, 716-725, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C8H16N2O3/c1-4(2)6(8(12)13)10-7(11)5(3)9/h4-6H,9H2,1-3H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1 InChIKey=LIWMQSWFLXEGMA-WDSKDSINSA-N Alternative IC50 value 371.89 uM Salampessy J., Reddy N., Kailasapathy K., Phillips M. Functional and potential therapeutic ACE-inhibitory peptides derived from bromelain hydrolysis of trevally proteins. J. Funct. Foods, 2015, 14, 716-725 Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to BIOPEP-UWM database of bioactive peptides (ID 8764) |
| Database reference: |
| BindingDB: ID BDBM50348854 BIOPEP-UWM database of bioactive peptides: ID 8764 BRENDA: Ligand Ala-Val CAS: Registry No 3303-45-5 ChEBI: ID 73809 ChEMBL: ID CHEMBL301674 ChemSpider: ID 87399 DFBP: DFBPACEI0225; EROP-Moscow: ID E16892 FeptideDB: ID 8764; 8951 HMDB: ID HMDB0028700 J-GLOBAL: ID 200907072905284216 Metabolights: ID MTBLC73809 Nikkaji: ID J149.640I PubChem: CID 96799 SureChEMBL: ID SCHEMBL595439 ZINC: ID ZINC000001575505 |