BIOPEP-UWM: Report
| ID | 8954 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 592.6397 | Monoisotopic mass | 592.2847 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sun L., Zhang Y., Zhuang Y. | |
| Title | |
| Antiphotoaging effect and purification of an antioxidant peptide from tilapia (Oreochromis niloticus) gelatin peptide. J. Funct. Foods., 5, 154-162, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SIMLES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C27H40N6O9/c1-15(2)10-18(28)24(38)32-20(14-34)26(40)29-12-22(36)31-19(11-16-5-7-17(35)8-6-16)25(39)30-13-23(37)33-9-3-4-21(33)27(41)42/h5-8,15,18-21,34-35H,3-4,9-14,28H2,1-2H3,(H,29,40)(H,30,39)(H,31,36)(H,32,38)(H,41,42)/t18-,19-,20-,21-/m0/s1 InChIKey: KUWWXIFDMBLLAJ-TUFLPTIASA-N |
| Database reference: |
| FeptideDB: ID 8954 |