BIOPEP-UWM: Report
| ID | 8955 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 640.7254 | Monoisotopic mass | 640.3210 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cai L., Wu X., Zhang Y., Li X., Ma S., Li J. | |
| Title | |
| Purification and characterization of three antioxidant peptides from protein hydrolysate of grass carp (Ctenopharyngodon idella) skin. J. Funct. Foods, 16, 234-242 (2015) | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C32H44N6O8/c33-15-5-4-9-24(32(45)46)35-29(42)25(17-20-7-2-1-3-8-20)37-31(44)27(19-39)38-30(43)26(18-21-11-13-22(40)14-12-21)36-28(41)23-10-6-16-34-23/h1-3,7-8,11-14,23-27,34,39-40H,4-6,9-10,15-19,33H2,(H,35,42)(H,36,41)(H,37,44)(H,38,43)(H,45,46)/t23-,24+,25+,26+,27+/m1/s1 INChIKey: VFQREFALXNFDKN-YLSALNBJSA-N |
| Database reference: |
| EROP-Moscow: ID E24462 FeptideDB: ID 8955 |