BIOPEP-UWM: Report
| ID | 8956 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 546.6144 | Monoisotopic mass | 546.2793 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cai L., Wu X., Zhang Y., Li X., Ma S., Li J. | |
| Title | |
| Purification and characterization of three antioxidant peptides from protein hydrolysate of grass carp (Ctenopharyngodon idella) skin. J. Funct. Foods, 16, 234-242, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C26H38N6O7/c1-16(2)11-19(26(38)39)31-22(34)14-28-25(37)20-9-6-10-32(20)23(35)15-29-24(36)18(30-21(33)13-27)12-17-7-4-3-5-8-17/h3-5,7-8,16,18-20H,6,9-15,27H2,1-2H3,(H,28,37)(H,29,36)(H,30,33)(H,31,34)(H,38,39)/t18-,19-,20-/m0/s1 InChIKey: BCFXQJLUOWPIEY-UFYCRDLUSA-N |
| Database reference: |
| FeptideDB: ID 8956 |