BIOPEP-UWM: Report
| ID | 8957 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 484.5484 | Monoisotopic mass | 484.2750 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cai L., Wu X., Zhang Y., Li X., Ma S., Li J. | |
| Title | |
| Purification and characterization of three antioxidant peptides from protein hydrolysate of grass carp (Ctenopharyngodon idella) skin. J. Funct. Foods, 16, 234-242 (2015) | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)O InChI=1S/C20H36N8O6/c1-11(2)16(21)17(31)26-9-14(29)25-10-15(30)27-12(5-3-7-24-20(22)23)18(32)28-8-4-6-13(28)19(33)34/h11-13,16H,3-10,21H2,1-2H3,(H,25,29)(H,26,31)(H,27,30)(H,33,34)(H4,22,23,24)/t12-,13+,16-/m0/s1 InChIKey: PWRJBTJZPIJYEF-ZENOOKHLSA-N |
| Database reference: |
| EROP-Moscow: ID E24464 |