BIOPEP-UWM: Report
| ID | 8963 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 602.6758 | Monoisotopic mass | 602.3264 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang S.K., Ismail A., Yanagita T., Esa N.M., Baharuldin M.T.H. | |
| Title | |
| Antioxidant peptides purified and identified from the oil palm (Elaeis guineensis Jacq.) kernel protein hydrolysate. J. Funct. Foods, 14, 63-75, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@@H](C)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@@H](C)O)C(O)=O InChI=1S/C26H46N6O10/c1-11(2)17(27)25(40)32-9-7-8-16(32)22(37)29-18(12(3)4)23(38)30-19(13(5)34)24(39)28-15(10-33)21(36)31-20(14(6)35)26(41)42/h11-20,33-35H,7-10,27H2,1-6H3,(H,28,39)(H,29,37)(H,30,38)(H,31,36)(H,41,42)/t13-,14-,15+,16+,17+,18+,19+,20+/m1/s1 InChIKey: KOYOWTYBCSEVPR-GSDNACIXSA-N |
| Database reference: |
| FeptideDB: ID 8963 |