BIOPEP-UWM: Report
| ID | 8964 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 648.7011 | Monoisotopic mass | 648.3318 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chang S. K., Ismail A., Yanagita T., Esa N. M., Baharuldin M. T. H. | |
| Title | |
| Antioxidant peptides purified and identified from the oil palm (Elaeis guineensis Jacq.) kernel protein hydrolysate. J. Funct. Foods, 14, 63-75, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C27H48N6O12/c1-11(2)7-15(28)22(39)32-21(14(6)36)26(43)33-20(13(5)35)25(42)30-16(8-12(3)4)23(40)29-17(9-19(37)38)24(41)31-18(10-34)27(44)45/h11-18,20-21,34-36H,7-10,28H2,1-6H3,(H,29,40)(H,30,42)(H,31,41)(H,32,39)(H,33,43)(H,37,38)(H,44,45)/t13-,14-,15+,16+,17+,18+,20+,21+/m1/s1 InChIKey=SADUBGMVWXPIFJ-XKZKVINKSA-N |
| Database reference: |
| FeptideDB: ID 8964 |