BIOPEP-UWM: Report
| ID | 8966 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1161.3075 | Monoisotopic mass | 1160.6283 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Baratzadeh M.-H., Asoodeh A., Chamani J. | |
| Title | |
| Antioxidant peptides obtained from goose egg white proteins by enzymatic hydrolysis. Int. J. Food Sci. Tech., 48, 1603-1609, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C51H84N16O15/c1-25(2)22-34(45(77)61-31(15-11-21-59-51(56)57)44(76)67-40(27(5)6)47(79)63-33(49(81)82)16-18-36(53)68)64-43(75)32(17-19-37(69)70)62-42(74)30(14-10-20-58-50(54)55)60-46(78)35(23-28-12-8-7-9-13-28)65-48(80)39(26(3)4)66-41(73)29(52)24-38(71)72/h7-9,12-13,25-27,29-35,39-40H,10-11,14-24,52H2,1-6H3,(H2,53,68)(H,60,78)(H,61,77)(H,62,74)(H,63,79)(H,64,75)(H,65,80)(H,66,73)(H,67,76)(H,69,70)(H,71,72)(H,81,82)(H4,54,55,58)(H4,56,57,59)/t29-,30-,31-,32-,33-,34-,35-,39-,40-/m0/s1 InChIKey=ZAWXVYPQDOLTPG-ISXKKGEESA-N |
| Database reference: |
| FeptideDB: ID 8966 |