BIOPEP-UWM: Report
| ID | 8969 |
| Name | Antioxidative peptide derived from chicken egg white |
| sequence |
| Function: | |||
| antioxidant peptide | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 763.7933 | Monoisotopic mass | 763.3489 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nimalaratne C., Bandara N., Wu J. P. | |
| Title | |
| Purification and characterization of antioxidant peptides from enzymatically hydrolyzed chicken egg white. Food Chem., 188, 467–472, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C33H49N9O12/c1-17(34)27(48)38-21(10-12-25(44)45)29(50)40-22(11-13-26(46)47)30(51)39-20(4-2-14-37-33(35)36)28(49)41-23(16-18-6-8-19(43)9-7-18)31(52)42-15-3-5-24(42)32(53)54/h6-9,17,20-24,43H,2-5,10-16,34H2,1H3,(H,38,48)(H,39,51)(H,40,50)(H,41,49)(H,44,45)(H,46,47)(H,53,54)(H4,35,36,37)/t17-,20-,21-,22-,23-,24-/m0/s1 InChIKey=XTMRHRGETWIKTB-YYOLRRQBSA-N Bioactivity was determined using ORAC assay. |
| Database reference: |
| FeptideDB: ID 8969 |