BIOPEP-UWM: Report
| ID | 8970 |
| Name | Antioxidative peptide derived from chicken egg white |
| sequence |
| Function: | |||
| antioxidant peptide | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 905.9252 | Monoisotopic mass | 905.3423 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nimalaratne C., Bandara N., Wu J. P. | |
| Title | |
| Purification and characterization of antioxidant peptides from enzymatically hydrolyzed chicken egg white. Food Chem., 188, 467–472, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C35H55N9O17S/c1-15(28(53)41-20(10-12-62-3)34(59)44-11-4-5-22(44)35(60)61)38-30(55)18(6-8-23(37)46)40-33(58)27(16(2)45)43-32(57)21(14-26(51)52)42-31(56)19(7-9-24(47)48)39-29(54)17(36)13-25(49)50/h15-22,27,45H,4-14,36H2,1-3H3,(H2,37,46)(H,38,55)(H,39,54)(H,40,58)(H,41,53)(H,42,56)(H,43,57)(H,47,48)(H,49,50)(H,51,52)(H,60,61)/t15-,16+,17-,18-,19-,20-,21-,22-,27-/m0/s1 InChIKey=MITREQUSAPQZPL-GYJHLJFESA-N Bioactivity was determined using ORAC assay. |
| Database reference: |
| FeptideDB: ID 8970 |