BIOPEP-UWM: Report
| ID | 8971 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 618.6769 | Monoisotopic mass | 618.3003 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cai L. Y., Wu X. S., Zhang Y. H., Li X. X., Ma S., Li J. R. | |
| Title | |
| Purification and characterization of three antioxidant peptides from protein hydrolysate of grass carp (Ctenopharyngodon idella) skin. J. Funct. Foods, 16, 234–242, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C29H42N6O9/c1-17(2)13-21(29(43)44)34-27(41)19(10-11-25(38)39)33-28(42)22-9-6-12-35(22)24(37)16-31-26(40)20(32-23(36)15-30)14-18-7-4-3-5-8-18/h3-5,7-8,17,19-22H,6,9-16,30H2,1-2H3,(H,31,40)(H,32,36)(H,33,42)(H,34,41)(H,38,39)(H,43,44)/t19-,20-,21-,22-/m0/s1 InChIKey: JNDYXZWSZUKLFY-CMOCDZPBSA-N Bioactivity was determined using the following assays: DPPH radical, hydroxyl radical, ABTS radical scavenging, inhibiting lipid peroxidation. |
| Database reference: |
| EROP-Moscow: ID E24463 FeptideDB: ID 8971 |