BIOPEP-UWM: Report
| ID | 8972 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from grass carp (Ctenopharyngodon idella) skin. | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 385.4177 | Monoisotopic mass | 385.2068 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cai L. Y., Wu X. S., Zhang Y. H., Li X. X., Ma S., Li J. R. | |
| Title | |
| Purification and characterization of three antioxidant peptides from protein hydrolysate of grass carp (Ctenopharyngodon idella) skin. J. Funct. Foods, 16, 234–242, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C15H27N7O5/c16-7-11(23)20-8-12(24)21-9(3-1-5-19-15(17)18)13(25)22-6-2-4-10(22)14(26)27/h9-10H,1-8,16H2,(H,20,23)(H,21,24)(H,26,27)(H4,17,18,19)/t9-,10-/m0/s1 InChIKey=KEJGRRIVVKYROG-UWVGGRQHSA-N Bioactivity was determined using the following assays: DPPH radical, hydroxyl radical, ABTS radical scavenging, inhibiting lipid peroxidation. |
| Database reference: |
| FeptideDB: ID 8972 |