BIOPEP-UWM: Report
| ID | 8973 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from bluefin leatherjacket skin (Navodon septentrionalis). | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 389.4031 | Monoisotopic mass | 389.1904 | |
| EC50 : | 242.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chi C. F., Wang B., Hu F.Y., Wang Y. M., Zhang B., Deng S. J., Wu C. W. | |
| Title | |
| Purification and identification of three novel antioxidant peptides from protein hydrolysate of bluefin leatherjacket (Navodon septentrionalis) skin. Food Res. Int., 73, 124–129, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CO)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C15H27N5O7/c1-8(2)3-9(15(26)27)19-13(24)6-17-12(23)5-18-14(25)10(7-21)20-11(22)4-16/h8-10,21H,3-7,16H2,1-2H3,(H,17,23)(H,18,25)(H,19,24)(H,20,22)(H,26,27)/t9-,10-/m0/s1 InChIKey=LSWKHOKZKFKUAY-UWVGGRQHSA-N Bioactivity was determined using the following assays: DPPH, HO, O2 - radical scavenging. IC50 value calculated for DPPH scavenging activity was 242 micrommoles. |
| Database reference: |
| FeptideDB: ID 8973 |