BIOPEP-UWM: Report
| ID | 8976 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from palm kernel cake proteins. | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 464.5108 | Monoisotopic mass | 464.2263 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zarei M., Ebrahimpour A., Abdul-Hamid A., Anwar F., Bakar F.A., Philip R., Saari N. | |
| Title | |
| Identification and characterization of papain-generated antioxidant peptides from palm kernel cake proteins. Food Res. Int., 62, 726–734, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of biactive peptides SMILES: NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C22H32N4O7/c1-3-13(2)19(26-17(27)12-23)21(31)25-16(11-14-7-5-4-6-8-14)20(30)24-15(22(32)33)9-10-18(28)29/h4-8,13,15-16,19H,3,9-12,23H2,1-2H3,(H,24,30)(H,25,31)(H,26,27)(H,28,29)(H,32,33)/t13-,15-,16-,19-/m0/s1 InChIKey=ZVUOHMJZVMUUQU-FJXLLPKBSA-N Bioactivity was determined using the following assays: DPPH radical scavenging, metal chelating ability. |
| Database reference: |
| FeptideDB: ID 8976 |