BIOPEP-UWM: Report
| ID | 8977 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from palm kernel cake proteins. | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1200.3848 | Monoisotopic mass | 1199.6432 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zarei M., Ebrahimpour A., Abdul-Hamid A., Anwar F., Bakar F.A., Philip R., Saari N. | |
| Title | |
| Identification and characterization of papain-generated antioxidant peptides from palm kernel cake proteins. Food Res. Int., 62, 726–734, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C58H85N15O13/c1-30(2)25-37(59)55(83)72-23-13-21-44(72)52(80)67-40(27-35-29-64-38-18-11-10-17-36(35)38)49(77)66-39(19-12-22-63-58(61)62)56(84)73-24-14-20-43(73)51(79)65-32(5)48(76)71-47(33(6)74)54(82)68-41(28-45(60)75)50(78)70-46(31(3)4)53(81)69-42(57(85)86)26-34-15-8-7-9-16-34/h7-11,15-18,29-33,37,39-44,46-47,64,74H,12-14,19-28,59H2,1-6H3,(H2,60,75)(H,65,79)(H,66,77)(H,67,80)(H,68,82)(H,69,81)(H,70,78)(H,71,76)(H,85,86)(H4,61,62,63)/t32-,33+,37-,39-,40-,41-,42-,43-,44-,46-,47-/m0/s1 InChIKey=NMPHIUVJSVDHKT-NFOZSYPSSA-N Bioactivity was determined using the following assays: DPPH radical scavenging, metal chelating ability. IC50 value for metal chelatin activity was 0,001 micromole. |
| Database reference: |
| FeptideDB: ID 8977 |