BIOPEP-UWM: Report
| ID | 8981 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from spotless smoothhound (Mustelus griseus) muscle. | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 681.7821 | Monoisotopic mass | 681.3911 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang B., Gong Y. D., Li Z. R., Yu D., Chi C. F., Ma J. Y. | |
| Title | |
| Isolation and characterisation of five novel antioxidant peptides from ethanol-soluble proteins hydrolysate of spotless smoothhound (Mustelus griseus) muscle. J. Funct. Foods, 6, 176–185, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C29H51N11O8/c1-5-15(3)22(39-21(42)11-30)27(46)40-23(16(4)6-2)26(45)38-20(13-41)25(44)37-19(10-17-12-33-14-35-17)24(43)36-18(28(47)48)8-7-9-34-29(31)32/h12,14-16,18-20,22-23,41H,5-11,13,30H2,1-4H3,(H,33,35)(H,36,43)(H,37,44)(H,38,45)(H,39,42)(H,40,46)(H,47,48)(H4,31,32,34)/t15-,16-,18-,19-,20-,22-,23-/m0/s1 InChIKey=HUVCGWLLVNFTSO-KEFICOIWSA-N Bioactivity was determined using the following assays: hydroxyl, ABTS, superoxide radical scavenging. |
| Database reference: |
| FeptideDB: ID 8981 |