BIOPEP-UWM: Report
| ID | 8983 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from spotless smoothhound (Mustelus griseus) muscle. | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 217.2218 | Monoisotopic mass | 217.1059 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang B., Gong Y. D., Li Z. R., Yu D., Chi C. F., Ma J. Y. | |
| Title | |
| Isolation and characterisation of five novel antioxidant peptides from ethanol-soluble proteins hydrolysate of spotless smoothhound (Mustelus griseus) muscle. J. Funct. Foods, 6, 176–185, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C8H15N3O4/c1-4(10-6(12)3-9)7(13)11-5(2)8(14)15/h4-5H,3,9H2,1-2H3,(H,10,12)(H,11,13)(H,14,15)/t4-,5-/m0/s1 InChIKey=PYTZFYUXZZHOAD-WHFBIAKZSA-N Bioactivity was determined using the following assays: hydroxyl, ABTS, superoxide radical scavenging. |
| Database reference: |
| BRENDA: Ligand Gly-Ala-Ala ChEBI: ID 144460 ChemSpider: ID 8641338 EPA CompTox: ID DTXSID50516005 FeptideDB: ID 8983 J-GLOBAL: ID 200907036296943341 Nikkaji: ID J151.050I PubChem: CID 10465927 Sabio-RK: ID 24921 SureChEMBL: ID SCHEMBL3087607 ZINC: ID ZINC2522559 |