BIOPEP-UWM: Report
| ID | 8984 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from spotless smoothhound (Mustelus griseus) muscle. | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 486.6005 | Monoisotopic mass | 486.3043 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang B., Gong Y. D., Li Z. R., Yu D., Chi C. F., Ma J. Y. | |
| Title | |
| Isolation and characterisation of five novel antioxidant peptides from ethanol-soluble proteins hydrolysate of spotless smoothhound (Mustelus griseus) muscle. J. Funct. Foods, 6, 176–185, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI=1S/C23H42N4O7/c1-7-14(6)19(23(33)34)27-22(32)17(11-13(4)5)26-21(31)16(10-12(2)3)25-20(30)15(24)8-9-18(28)29/h12-17,19H,7-11,24H2,1-6H3,(H,25,30)(H,26,31)(H,27,32)(H,28,29)(H,33,34)/t14-,15-,16-,17-,19-/m0/s1 InChIKey=OKYVUSBKQZSFEU-WSRJKRBPSA-N Bioactivity was determined using the following assays: hydroxyl, ABTS, superoxide radical scavenging. |
| Database reference: |
| FeptideDB: ID 8984 |