BIOPEP-UWM: Report
| ID | 8985 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidant peptide derived from spotless smoothhound (Mustelus griseus) muscle. | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 519.5891 | Monoisotopic mass | 519.2684 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang B., Gong Y. D., Li Z. R., Yu D., Chi C. F., Ma J. Y. | |
| Title | |
| Isolation and characterisation of five novel antioxidant peptides from ethanol-soluble proteins hydrolysate of spotless smoothhound (Mustelus griseus) muscle. J. Funct. Foods, 6, 176–185, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C25H37N5O7/c26-13-5-4-9-17(27)22(33)29-19(15-16-7-2-1-3-8-16)24(35)30-14-6-10-20(30)23(34)28-18(25(36)37)11-12-21(31)32/h1-3,7-8,17-20H,4-6,9-15,26-27H2,(H,28,34)(H,29,33)(H,31,32)(H,36,37)/t17-,18-,19-,20-/m0/s1 InChIKey=GATAAMVKUSVJFO-MUGJNUQGSA-N Bioactivity was determined using the following assays: hydroxyl, ABTS, superoxide radical scavenging. |
| Database reference: |
| FeptideDB: ID 8985 |